ChemNet > CAS > 342002-82-8 4-Isopropoxycarbonylphenylboronic acid
342002-82-8 4-Isopropoxycarbonylphenylboronic acid
Naam product |
4-Isopropoxycarbonylphenylboronic acid |
Synoniemen |
{4-[(1-methylethoxy)carbonyl]phenyl}boronic acid |
MF |
C10H13BO4 |
Molecuulgewicht |
208.0188 |
InChI |
InChI=1/C10H13BO4/c1-7(2)15-10(12)8-3-5-9(6-4-8)11(13)14/h3-7,13-14H,1-2H3 |
CAS-nummer |
342002-82-8 |
Moleculaire Structuur |
|
Dichtheid |
1.17g/cm3 |
Smeltpunt |
111℃ |
Kookpunt |
359°C at 760 mmHg |
Brekingsindex |
1.519 |
Vlampunt |
170.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|